CymitQuimica logo

CAS 1060817-68-6

:

3-(2-Bromo-4-methylphenyl)-2-oxazolidinone

Description:
3-(2-Bromo-4-methylphenyl)-2-oxazolidinone is a chemical compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. The presence of the 2-bromo-4-methylphenyl group indicates that the compound has a bromine atom and a methyl group attached to a phenyl ring, contributing to its unique reactivity and potential biological activity. This compound may exhibit properties such as antimicrobial or anti-inflammatory effects, typical of oxazolidinone derivatives, which are often explored in medicinal chemistry. The molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions or cyclization processes. Additionally, the bromine substituent can enhance the compound's lipophilicity, potentially affecting its pharmacokinetics and bioavailability. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-(2-Bromo-4-methylphenyl)-2-oxazolidinone represents a class of compounds with significant interest in both synthetic and medicinal chemistry.
Formula:C10H10BrNO2
InChI:InChI=1S/C10H10BrNO2/c1-7-2-3-9(8(11)6-7)12-4-5-14-10(12)13/h2-3,6H,4-5H2,1H3
InChI key:InChIKey=UVSAZZKXQHVWGI-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC(C)=C1)N2C(=O)OCC2
Synonyms:
  • 3-(2-Bromo-4-methylphenyl)-2-oxazolidinone
  • 2-Oxazolidinone, 3-(2-bromo-4-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.