CAS 1060817-75-5

5-(3-Methyl-5-isoxazolyl)-2-furansulfonyl chloride

Description:

5-(3-Methyl-5-isoxazolyl)-2-furansulfonyl chloride is a chemical compound characterized by its unique structural features, which include a furan ring and an isoxazole moiety. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It is known for its reactivity, particularly due to the presence of the sulfonyl chloride functional group, which makes it a useful intermediate in organic synthesis, particularly in the preparation of sulfonamides and other derivatives. The isoxazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the methyl group on the isoxazole enhances its lipophilicity, which can influence its pharmacokinetic properties. As with many sulfonyl chlorides, it is important to handle this compound with care, as it can react vigorously with water and other nucleophiles, releasing hydrochloric acid and potentially leading to hazardous conditions. Proper safety protocols should be followed when working with this substance in a laboratory setting.

Formula: C₈H₆ClNO₄S

InChI: InChI=1S/C8H6ClNO4S/c1-5-4-7(14-10-5)6-2-3-8(13-6)15(9,11)12/h2-4H,1H3

InChI key: InChIKey=HAAGKUCFHFJVMM-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1OC(=CC1)C2=CC(C)=NO2

Synonyms:

• 2-Furansulfonyl chloride, 5-(3-methyl-5-isoxazolyl)-
• 5-(3-Methyl-5-isoxazolyl)-2-furansulfonyl chloride

5-(3-methyl-5-isoxazolyl)-2-furansulfonyl chloride

CAS: 1060817-75-5

Formula: C₈H₆ClNO₄S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 247.65

Ref: 10-F311847