CAS 106092-09-5: (6S)-4,5,6,7-Tetrahydro-2,6-benzothiazolediamine
Description:(6S)-4,5,6,7-Tetrahydro-2,6-benzothiazolediamine is a chemical compound characterized by its unique bicyclic structure, which includes a benzothiazole moiety fused with a saturated ring system. This compound features a thiol group and two amine functionalities, contributing to its potential reactivity and biological activity. The stereochemistry indicated by the (6S) designation suggests that it possesses specific spatial arrangements of its atoms, which can influence its interactions in biological systems. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of nitrogen and sulfur in its structure may impart unique properties, such as the ability to form hydrogen bonds or participate in redox reactions. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, making it a subject of interest in both synthetic and applied chemistry. Overall, (6S)-4,5,6,7-Tetrahydro-2,6-benzothiazolediamine exemplifies the complexity and diversity of organic compounds in chemical research.
Formula:C7H11N3S
InChI:InChI=1S/C7H11N3S/c8-4-1-2-5-6(3-4)11-7(9)10-5/h4H,1-3,8H2,(H2,9,10)/t4-/m0/s1
InChI key:InChIKey=DRRYZHHKWSHHFT-BYPYZUCNSA-N
SMILES:N1=C(SC2=C1CCC(N)C2)N
- Synonyms:
- (-)-2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole
- (6S)-(-)-2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole
- (6S)-4,5,6,7-Tetrahydro-2,6-benzothiazolediamine
- (6S)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine
- (S)-4,5,6,7-Tetrahydro-2,6-benzothiazolediamine
- (S)-4,5,6,7-Tetrahydrobenzo[1,2-d]thiazole-2,6-diamine
- (S)-4,5,6,7-Tetrahydrobenzo[d]thiazol-2,6-diamine
- (S)-4,5,6,7-Tetrahydrobenzo[d]thiazole-2,6-diamine
- (S)-4,5,6,7-Tetrahydrobenzothiazole-2,6-diamine
- 2,6-Benzothiazolediamine, 4,5,6,7-tetrahydro-, (6S)-
- See more synonyms
- 2,6-Benzothiazolediamine, 4,5,6,7-tetrahydro-, (S)-
- S-2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole