CAS 106114-40-3
:3-iodopropyl-1-trifluoromethanesulfonate
Description:
3-Iodopropyl-1-trifluoromethanesulfonate, with the CAS number 106114-40-3, is an organosulfonate compound characterized by the presence of a trifluoromethanesulfonate group and an iodine atom attached to a propyl chain. This compound is typically used as a reactive intermediate in organic synthesis, particularly in the formation of carbon-carbon bonds and in nucleophilic substitution reactions. The trifluoromethanesulfonate moiety enhances the electrophilicity of the carbon atom to which it is attached, making it a useful reagent in various chemical transformations. The iodine atom serves as a leaving group, facilitating the substitution process. Additionally, the presence of the trifluoromethyl group imparts unique electronic properties, influencing the reactivity and stability of the compound. Due to its specific functional groups, 3-iodopropyl-1-trifluoromethanesulfonate is of interest in medicinal chemistry and materials science, where it can be utilized to synthesize complex molecules or modify existing ones. Safety precautions should be observed when handling this compound, as it may pose health risks associated with its reactive nature.
Formula:C4H6F3IO3S
InChI:InChI=1/C4H6F3IO3S/c5-4(6,7)12(9,10)11-3-1-2-8/h1-3H2
SMILES:C(CI)COS(=O)(=O)C(F)(F)F
Synonyms:- 3-Iodopropyl-1-triflate
- 3-Iodopropyl Trifluoromethanesulfonate
- 3-Iodopropyl-1-trifluoromethanesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.