CymitQuimica logo

CAS 1061318-82-8

:

6-Iodo-N,N-dimethyl-1,3-benzodioxol-5-amine

Description:
6-Iodo-N,N-dimethyl-1,3-benzodioxol-5-amine is a chemical compound characterized by its unique structure, which includes a benzodioxole moiety and an amine functional group. The presence of the iodine atom at the 6-position of the benzodioxole ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic amine and may exhibit properties such as being a potential precursor in synthetic organic chemistry or a candidate for pharmacological research. Its dimethylamino group enhances its solubility in organic solvents and may influence its interaction with biological targets. The compound's molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the presence of the benzodioxole framework may impart specific electronic properties, making it of interest in the development of new materials or pharmaceuticals. As with any chemical substance, safety and handling precautions should be observed, particularly due to the presence of iodine, which can be hazardous in certain contexts.
Formula:C9H10INO2
InChI:InChI=1S/C9H10INO2/c1-11(2)7-4-9-8(3-6(7)10)12-5-13-9/h3-4H,5H2,1-2H3
InChI key:InChIKey=CPVFDXPSIYCDDB-UHFFFAOYSA-N
SMILES:N(C)(C)C=1C=C2C(=CC1I)OCO2
Synonyms:
  • 1,3-Benzodioxol-5-amine, 6-iodo-N,N-dimethyl-
  • 6-Iodo-N,N-dimethylbenzo[d][1,3]dioxol-5-amine
  • 6-Iodo-N,N-dimethyl-1,3-benzodioxol-5-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.