CAS 106132-78-9
:valproic acid hydroxamate
Description:
Valproic acid hydroxamate, with the CAS number 106132-78-9, is a derivative of valproic acid, which is primarily known for its use as an anticonvulsant and mood-stabilizing agent. This compound features a hydroxamate functional group, which is characterized by the presence of a hydroxylamine moiety attached to a carboxylic acid. The introduction of the hydroxamate group can enhance the compound's biological activity and may influence its pharmacological properties. Valproic acid hydroxamate is typically studied for its potential therapeutic applications, particularly in the context of neuroprotection and cancer treatment, as it may exhibit different mechanisms of action compared to its parent compound. The substance is likely to be soluble in polar solvents, and its stability can be influenced by pH and temperature. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the compound may have specific safety considerations in laboratory or clinical settings.
Formula:C8H17NO2
InChI:InChI=1/C8H17NO2/c1-3-5-7(6-4-2)8(10)9-11/h7,11H,3-6H2,1-2H3,(H,9,10)
SMILES:CCCC(CCC)C(=NO)O
Synonyms:- N-Hydroxy-2-propylpentanamide
- Pentanamide, N-hydroxy-2-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
