CymitQuimica logo

CAS 106147-71-1

:

5-[1-(diphenylmethyl)-1-methoxybutyl]-1H-imidazole

Description:
5-[1-(Diphenylmethyl)-1-methoxybutyl]-1H-imidazole, with the CAS number 106147-71-1, is a chemical compound characterized by its imidazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features a diphenylmethyl group, contributing to its lipophilicity and potential interactions in biological systems. The methoxybutyl substituent enhances its solubility and may influence its pharmacokinetic properties. Typically, imidazole derivatives are known for their diverse biological activities, including antifungal, antibacterial, and anti-inflammatory properties. The presence of the diphenylmethyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structure may allow for interactions with various biological targets, making it of interest in drug design and discovery. Its stability, reactivity, and specific interactions would depend on the surrounding conditions, such as pH and solvent, which are crucial for understanding its behavior in both laboratory and biological contexts.
Formula:C21H24N2O
InChI:InChI=1/C21H24N2O/c1-3-14-21(24-2,19-15-22-16-23-19)20(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,15-16,20H,3,14H2,1-2H3,(H,22,23)
SMILES:CCCC(c1cnc[nH]1)(C(c1ccccc1)c1ccccc1)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.