CymitQuimica logo

CAS 106148-27-0

:

1-(2-Phenylethyl)-4-(phenylmethyl)-2,6-piperazinedione

Description:
1-(2-Phenylethyl)-4-(phenylmethyl)-2,6-piperazinedione, with the CAS number 106148-27-0, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features two distinct aromatic substituents: a phenylethyl group and a phenylmethyl group, contributing to its potential biological activity and lipophilicity. The presence of the piperazinedione moiety suggests that it may exhibit properties typical of piperazine derivatives, such as interactions with neurotransmitter receptors. Its structural complexity may influence its solubility, stability, and reactivity, making it of interest in medicinal chemistry and pharmacology. The compound's potential applications could include roles in drug development, particularly in targeting central nervous system disorders, although specific biological activities would require further investigation through empirical studies. As with many organic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity.
Formula:C19H20N2O2
InChI:InChI=1S/C19H20N2O2/c22-18-14-20(13-17-9-5-2-6-10-17)15-19(23)21(18)12-11-16-7-3-1-4-8-16/h1-10H,11-15H2
InChI key:InChIKey=FDHZQDHDJVZPMI-UHFFFAOYSA-N
SMILES:C(N1CC(=O)N(CCC2=CC=CC=C2)C(=O)C1)C3=CC=CC=C3
Synonyms:
  • 2,6-Piperazinedione, 1-(2-phenylethyl)-4-(phenylmethyl)-
  • 1-(2-Phenylethyl)-4-(phenylmethyl)-2,6-piperazinedione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.