CAS 106165-42-8

(4-chlorophenyl)(cyclohexyl)methanol

Description:

(4-chlorophenyl)(cyclohexyl)methanol, with the CAS number 106165-42-8, is an organic compound characterized by the presence of a chlorinated phenyl group and a cyclohexyl group attached to a methanol moiety. This compound features a hydroxyl (-OH) functional group, which contributes to its classification as an alcohol. The presence of the 4-chloro substituent on the phenyl ring can influence its reactivity and solubility, potentially enhancing its lipophilicity due to the bulky cyclohexyl group. The compound may exhibit moderate polarity due to the hydroxyl group, which can engage in hydrogen bonding, affecting its boiling and melting points. Additionally, the structural arrangement suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such compounds may serve as intermediates or active ingredients. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups in a given formulation.

Formula: C₁₃H₁₇ClO

InChI: InChI=1/C13H17ClO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h6-10,13,15H,1-5H2

SMILES: C1CCC(CC1)C(c1ccc(cc1)Cl)O