CAS 1061682-35-6

1,1-Dimethylethyl 3-(2,2-dimethylpropyl)-3-hydroxy-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl 3-(2,2-dimethylpropyl)-3-hydroxy-1-pyrrolidinecarboxylate, identified by its CAS number 1061682-35-6, is a chemical compound that belongs to the class of pyrrolidine derivatives. This substance features a pyrrolidine ring, which is a five-membered cyclic amine, and is characterized by the presence of a carboxylate functional group and a hydroxy group. The compound exhibits a branched alkyl substituent, specifically a 2,2-dimethylpropyl group, which contributes to its steric bulk and potentially influences its reactivity and solubility. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its hydrophobic characteristics. Such structural features may affect the compound's biological activity, making it of interest in medicinal chemistry and pharmacology. Additionally, the compound's stability, solubility, and reactivity can be influenced by the steric hindrance introduced by its bulky substituents. Overall, this compound's unique structure suggests potential applications in various chemical and pharmaceutical contexts.

Formula: C₁₄H₂₇NO₃

InChI: InChI=1S/C14H27NO3/c1-12(2,3)9-14(17)7-8-15(10-14)11(16)18-13(4,5)6/h17H,7-10H2,1-6H3

InChI key: InChIKey=IGZIUCPTVQPWPC-UHFFFAOYSA-N

SMILES: C(C(C)(C)C)C1(O)CN(C(OC(C)(C)C)=O)CC1

Synonyms:

• 1-Pyrrolidinecarboxylic acid, 3-(2,2-dimethylpropyl)-3-hydroxy-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-(2,2-dimethylpropyl)-3-hydroxy-1-pyrrolidinecarboxylate