CymitQuimica logo

CAS 1061682-67-4

:

4-(3,3-Difluoro-1-pyrrolidinyl)piperidine

Description:
4-(3,3-Difluoro-1-pyrrolidinyl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a pyrrolidine moiety substituted with difluoromethyl groups. This compound is typically classified as a nitrogen-containing heterocycle, which contributes to its potential biological activity. The presence of fluorine atoms often enhances the lipophilicity and metabolic stability of the molecule, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit properties such as being a potential ligand for various receptors or enzymes, and its structural features could influence its pharmacokinetic and pharmacodynamic profiles. Additionally, the specific arrangement of atoms and functional groups can affect its reactivity and interactions with other chemical species. As with many compounds in this category, safety and handling precautions are essential due to the potential for biological activity and toxicity. Further studies would be necessary to fully elucidate its properties and applications in various fields, including drug discovery and development.
Formula:C9H16F2N2
InChI:InChI=1S/C9H16F2N2/c10-9(11)3-6-13(7-9)8-1-4-12-5-2-8/h8,12H,1-7H2
InChI key:InChIKey=HLHFAPNXTVOVGE-UHFFFAOYSA-N
SMILES:FC1(F)CN(CC1)C2CCNCC2
Synonyms:
  • 4-(3,3-Difluoro-1-pyrrolidinyl)piperidine
  • Piperidine, 4-(3,3-difluoro-1-pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.