CymitQuimica logo

CAS 106209-27-2

:

4-Ethenyl-1,3-benzenediol

Description:
4-Ethenyl-1,3-benzenediol, also known as 4-vinylcatechol, is an organic compound characterized by its vinyl group and catechol structure. It features a benzene ring with two hydroxyl (-OH) groups positioned at the 1 and 3 positions, and a vinyl group (-CH=CH2) at the 4 position. This compound is typically a colorless to light yellow liquid and is soluble in organic solvents. It exhibits properties such as being a potential monomer for polymerization, which can lead to the formation of various polymeric materials. The presence of hydroxyl groups contributes to its reactivity, allowing it to participate in various chemical reactions, including oxidation and polymerization. Additionally, 4-ethenyl-1,3-benzenediol may have applications in the synthesis of specialty chemicals and materials due to its functional groups. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure.
Formula:C8H8O2
InChI:InChI=1S/C8H8O2/c1-2-6-3-4-7(9)5-8(6)10/h2-5,9-10H,1H2
InChI key:InChIKey=CGVSVWWXNAFRRH-UHFFFAOYSA-N
SMILES:C(=C)C1=C(O)C=C(O)C=C1
Synonyms:
  • 2,4-Dihydroxystyrene
  • 4-Ethenyl-1,3-benzenediol
  • 1,3-Benzenediol, 4-ethenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.