CAS 106214-24-8
:BUTYL 4-[(CHLOROACETYL)AMINO]BENZOATE
Description:
Butyl 4-[(chloroacetyl)amino]benzoate, identified by its CAS number 106214-24-8, is an organic compound that belongs to the class of benzoates. It features a butyl group attached to a benzoate moiety, which is further substituted with a chloroacetylamino group. This structure imparts specific chemical characteristics, including moderate solubility in organic solvents and limited solubility in water due to its hydrophobic butyl chain. The presence of the chloroacetyl group suggests potential reactivity, particularly in nucleophilic substitution reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical applications. Its synthesis typically involves the reaction of butyl benzoate with chloroacetyl chloride in the presence of a base. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, butyl 4-[(chloroacetyl)amino]benzoate is a versatile compound with applications in various chemical fields, warranting further investigation into its properties and uses.
Formula:C13H16ClNO3
InChI:InChI=1/C13H16ClNO3/c1-2-3-8-18-13(17)10-4-6-11(7-5-10)15-12(16)9-14/h4-7H,2-3,8-9H2,1H3,(H,15,16)
SMILES:CCCCOC(=O)c1ccc(cc1)NC(=O)CCl
Synonyms:- Benzoic Acid, 4-[(2-Chloroacetyl)Amino]-, Butyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.