CAS 106237-17-6

2-Oxatricyclo[3.3.1.13,7]decane-1-carboxylic acid

Description:

2-Oxatricyclo[3.3.1.1^3,7]decane-1-carboxylic acid, identified by its CAS number 106237-17-6, is a bicyclic organic compound characterized by a unique tricyclic structure that includes an oxygen atom within one of its rings. This compound features a carboxylic acid functional group, which contributes to its acidity and reactivity. The presence of the oxatricyclo framework imparts specific steric and electronic properties, making it of interest in various chemical applications, including organic synthesis and medicinal chemistry. The compound's structure allows for potential interactions with biological systems, which may lead to pharmacological activities. Additionally, its unique ring system may influence its solubility, stability, and reactivity with other chemical species. While specific physical properties such as melting point, boiling point, and solubility may vary, they are essential for understanding the compound's behavior in different environments. Overall, 2-Oxatricyclo[3.3.1.1^3,7]decane-1-carboxylic acid represents a fascinating subject for further research in both synthetic and applied chemistry.

Formula: C₁₀H₁₄O₃

InChI: InChI=1S/C10H14O3/c11-9(12)10-4-6-1-7(5-10)3-8(2-6)13-10/h6-8H,1-5H2,(H,11,12)

InChI key: InChIKey=SDGBFSSBRFDOKB-UHFFFAOYSA-N

SMILES: C(O)(=O)C12CC3CC(O1)CC(C2)C3

Synonyms:

• 2-Oxatricyclo[3.3.1.13,7]decane-1-carboxylic acid

2-Oxatricyclo[3.3.1.1,3,7]decane-1-carboxylic acid

CAS: 106237-17-6

Versatile small molecule scaffold

Formula: C₁₀H₁₄O₃

Purity: Min. 95%

Molecular weight: 182.22 g/mol

Ref: 3D-GEA23717