CymitQuimica logo

CAS 1062404-66-3

:

N-3-Piperidinylcyclopropanecarboxamide

Description:
N-3-Piperidinylcyclopropanecarboxamide is a chemical compound characterized by its unique structural features, which include a piperidine ring and a cyclopropane moiety. This compound typically exhibits properties associated with amides, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often found in pharmaceuticals and can interact with various biological targets. The cyclopropane structure may impart strain, potentially affecting the compound's stability and reactivity. In terms of physical properties, compounds of this nature may be solid or liquid at room temperature, depending on their molecular weight and intermolecular interactions. Additionally, N-3-Piperidinylcyclopropanecarboxamide may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully elucidate its biological activity, pharmacokinetics, and potential applications in drug development.
Formula:C9H16N2O
InChI:InChI=1S/C9H16N2O/c12-9(7-3-4-7)11-8-2-1-5-10-6-8/h7-8,10H,1-6H2,(H,11,12)
InChI key:InChIKey=XOXSBDNCEBIBQH-UHFFFAOYSA-N
SMILES:C(NC1CCCNC1)(=O)C2CC2
Synonyms:
  • Cyclopropanecarboxamide, N-3-piperidinyl-
  • N-3-Piperidinylcyclopropanecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.