
CAS 1062541-77-8
:6-Bromo-3-methoxy-2,4-dimethylpyridine
Description:
6-Bromo-3-methoxy-2,4-dimethylpyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of bromine at the 6-position and a methoxy group at the 3-position, along with two methyl groups at the 2 and 4 positions, contributes to its unique chemical properties. This compound is typically a pale yellow to brown liquid or solid, depending on its purity and form. It is soluble in organic solvents and may exhibit moderate polarity due to the methoxy group. The bromine substituent can enhance its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 6-Bromo-3-methoxy-2,4-dimethylpyridine is a versatile compound with significant potential in chemical research and industry.
Formula:C8H10BrNO
InChI:InChI=1S/C8H10BrNO/c1-5-4-7(9)10-6(2)8(5)11-3/h4H,1-3H3
InChI key:InChIKey=PENZXXCPRLNOBE-UHFFFAOYSA-N
SMILES:O(C)C=1C(C)=CC(Br)=NC1C
Synonyms:- 6-Bromo-3-methoxy-2,4-dimethylpyridine
- 2-Bromo-5-methoxy-4,6-dimethylpyridine
- Pyridine, 6-bromo-3-methoxy-2,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
