CAS 106262-38-8
:5-amino-2-ethoxybenzoic acid
Description:
5-Amino-2-ethoxybenzoic acid is an organic compound characterized by its amino and carboxylic acid functional groups, which contribute to its acidic and basic properties. The presence of the ethoxy group enhances its solubility in organic solvents while maintaining some hydrophilicity due to the carboxylic acid. This compound typically appears as a white to off-white solid and is often used in pharmaceutical applications, particularly in the synthesis of various bioactive molecules. Its molecular structure includes a benzene ring substituted with an amino group at the 5-position and an ethoxy group at the 2-position, which influences its reactivity and interaction with biological systems. The compound's properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and storage, as with any chemical, to ensure proper laboratory practices are followed.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c1-2-13-8-4-3-6(10)5-7(8)9(11)12/h3-5H,2,10H2,1H3,(H,11,12)
SMILES:CCOc1ccc(cc1C(=O)O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.