CAS 106266-04-0: Methanone, (2,4-difluorophenyl)-4-piperidinyl-, hydrochloride (1:1)
Description:Methanone, (2,4-difluorophenyl)-4-piperidinyl-, hydrochloride (1:1), commonly known by its CAS number 106266-04-0, is a chemical compound characterized by its structure, which includes a piperidine ring and a difluorophenyl group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceutical contexts. The presence of fluorine atoms in the phenyl group can influence the compound's biological activity, potentially enhancing its potency or selectivity in interactions with biological targets. Methanone derivatives often exhibit properties such as analgesic or anti-inflammatory effects, making them of interest in medicinal chemistry. Additionally, the piperidine moiety contributes to the compound's ability to interact with neurotransmitter systems, which may be relevant in the development of therapeutic agents. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity, and proper characterization through techniques like NMR or mass spectrometry is crucial for research and application.
Formula:C12H13F2NO·ClH
InChI:InChI=1S/C12H13F2NO.ClH/c13-9-1-2-10(11(14)7-9)12(16)8-3-5-15-6-4-8;/h1-2,7-8,15H,3-6H2;1H
InChI key:InChIKey=QPJONRGTWKXJLG-UHFFFAOYSA-N
SMILES:Cl.O=C(C1=CC=C(F)C=C1F)C2CCNCC2
- Synonyms:
- (2,4-DIFLUOROPHENYL)-(4-PIPERIDINYL)METHANONE OXIME HCl
- (2,4-Difluorophenyl)(Piperidin-4-Yl)Methanone Hydrochloride (1:1)
- (2,4-Difluorophenyl)(piperidin-4-yl)methanone hydrochloride
- 4-(2,4-Difluorobenzoyl)-Piperidine Hydrochloride
- 4-(2,4-Difluorobenzoyl)piperidine Hydrocholide
- Intermediates For Risperidone
- Methanone, (2,4-difluorophenyl)-4-piperidinyl-, hydrochloride
- Methanone, (2,4-difluorophenyl)-4-piperidinyl-, hydrochloride (1:1)
- 4-(2,4-DIFLUOROBENZOYL)-PIPERIDINE HCl
