CAS 106266-09-5
:Desfluororisperidone
Description:
Desfluororisperidone is a chemical compound that serves as an active metabolite of risperidone, an atypical antipsychotic medication. It is characterized by its structural modifications that enhance its pharmacological properties. The compound is known for its affinity for various neurotransmitter receptors, particularly dopamine D2 and serotonin 5-HT2A receptors, which contribute to its antipsychotic effects. Desfluororisperidone exhibits a relatively high lipophilicity, influencing its distribution and bioavailability in biological systems. Its pharmacokinetic profile indicates a significant half-life, allowing for sustained therapeutic effects. Additionally, the compound is subject to metabolic processes in the liver, primarily through cytochrome P450 enzymes. Safety and efficacy profiles are evaluated in clinical settings, with attention to potential side effects, including metabolic syndrome and extrapyramidal symptoms. Overall, desfluororisperidone plays a crucial role in the pharmacological landscape of treating schizophrenia and other mood disorders, reflecting the importance of its chemical characteristics in therapeutic applications.
Formula:C23H28N4O2
InChI:InChI=1S/C23H28N4O2/c1-16-18(23(28)27-12-5-4-8-21(27)24-16)11-15-26-13-9-17(10-14-26)22-19-6-2-3-7-20(19)29-25-22/h2-3,6-7,17H,4-5,8-15H2,1H3
InChI key:InChIKey=PLOGUXWMVNJOPF-UHFFFAOYSA-N
SMILES:C(CC=1C(=O)N2C(=NC1C)CCCC2)N3CCC(C=4C=5C(ON4)=CC=CC5)CC3
Synonyms:- 3-[2-[4-(1,2-Benzisoxazol-3-yl)-1-piperidinyl]ethyl]-6,7,8,9-tetrahydro-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one
- 1,2-Benzisoxazole, 4H-pyrido[1,2-a]pyrimidin-4-one deriv.
- 4H-Pyrido[1,2-a]pyrimidin-4-one, 3-[2-[4-(1,2-benzisoxazol-3-yl)-1-piperidinyl]ethyl]-6,7,8,9-tetrahydro-2-methyl-
- Desfluororisperidone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Desfluoro Risperidone (3-{2-[4-(Benzisoxazol-3-yl)piperidin-1-yl]ethyl}-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-one)
CAS:Nucleic acids and their salts, whether or not chemically defined; other heterocyclic compounds, nesoiFormula:C23H28N4O2Color and Shape:White PowderMolecular weight:392.22123Risperidone EP Impurity K (Desfluoro Risperidone)
CAS:Formula:C23H28N4O2Color and Shape:White To Off-White SolidMolecular weight:392.503-(2-(4-(Benzo[d]isoxazol-3-yl)piperidin-1-yl)ethyl)-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-one
CAS:3-(2-(4-(Benzo[d]isoxazol-3-yl)piperidin-1-yl)ethyl)-2-methyl-6,7,8,9-tetrahydro-4H-pyrido[1,2-a]pyrimidin-4-onePurity:98%Molecular weight:392.5g/molDesfluoro Risperidone
CAS:Controlled ProductImpurity Risperidone EP Impurity K
Applications Desfluoro Risperidone (Risperidone EP Impurity K) is a Risperidone (R525000) impurity, as antipsychotics.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C23H28N4O2Color and Shape:NeatMolecular weight:392.493-[2-[4-(1,2-Benzisoxazol-3-yl)-1-piperidinyl]ethyl]-6,7,8,9-tetrahydro-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one
CAS:3-[2-[4-(1,2-Benzisoxazol-3-yl)-1-piperidinyl]ethyl]-6,7,8,9-tetrahydro-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one is an analog of the antibacterial drug cefuroxime. It has been shown to be a potent inhibitor of bacterial DNA gyrase and topoisomerase IV. This compound has been shown to have a greater degree of activity against Gram Positive bacteria than Gram Negative bacteria in vitro. 3-[2-[4-(1,2-Benzisoxazol-3-yl)-1-piperidinyl]ethyl]-6,7,8,9-tetrahydro-- 2 -methyl-- 4H-- pyrido[1,2-- a]pyrimidin-- 4 -one is not active against acidFormula:C23H28N4O2Purity:Min. 95%Molecular weight:392.49 g/mol







