CAS 106276-04-4
:[2-(2-MORPHOLINOETHOXY)PHENYL]METHANOL
Description:
[2-(2-Morpholinoethoxy)phenyl]methanol, with the CAS number 106276-04-4, is an organic compound characterized by its phenolic structure, which includes a methanol group and a morpholinoethoxy substituent. This compound typically exhibits properties associated with both alcohols and ethers, such as solubility in polar solvents and potential hydrogen bonding capabilities due to the hydroxyl (-OH) group. The morpholino group contributes to its potential biological activity, as morpholines are often involved in medicinal chemistry. The presence of the ethoxy linkage enhances its lipophilicity, which may influence its pharmacokinetic properties. Additionally, the compound may exhibit moderate to high stability under standard conditions, although specific reactivity can depend on the surrounding environment and functional groups present. Its applications may span various fields, including pharmaceuticals, where it could serve as an intermediate or active ingredient in drug formulations. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C13H19NO3
InChI:InChI=1/C13H19NO3/c15-11-12-3-1-2-4-13(12)17-10-7-14-5-8-16-9-6-14/h1-4,15H,5-11H2
SMILES:c1ccc(c(c1)CO)OCCN1CCOCC1
Synonyms:- [2-(2-Morpholin-4-Ylethoxy)Phenyl]Methanol
- [2-(2-morpholinoethoxy)phenyl]methanol
- 2-(2-morpholino-ethoxy)-benzyl alcohol
- Benzenemethanol, 2-[2-(4-morpholinyl)ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.