CAS 106291-25-2
:3'-FLUORO-4'-METHOXYLBIPHENYL-4-CARBOXYLIC ACID
Description:
3'-Fluoro-4'-methoxylbiphenyl-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 3' position and a methoxy group at the 4' position on one of the phenyl rings contributes to its unique chemical properties, including potential alterations in polarity and reactivity. The carboxylic acid functional group at the 4-position of the second phenyl ring imparts acidic characteristics, allowing for potential interactions in various chemical environments. This compound may exhibit interesting biological activity due to its structural features, making it a candidate for research in medicinal chemistry. Its solubility, stability, and reactivity can be influenced by the substituents present, which may affect its applications in pharmaceuticals or materials science. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the fluoro group, which can impact toxicity and environmental behavior.
Formula:C14H11FO3
InChI:InChI=1/C14H11FO3/c1-18-13-7-6-11(8-12(13)15)9-2-4-10(5-3-9)14(16)17/h2-8H,1H3,(H,16,17)
Synonyms:- 3'-Fluoro-4'-Methoxy-Biphenyl-4-Carboxylic Acid
- 4-(3-Fluoro-4-methoxyphenyl)benzoic acid
- 4-(3-Fluoro-5-methoxyphenyl)benzoic acid
- 4-(5-Fluoro-2-methoxyphenyl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
