CAS 106308-42-3

1H-1,2,3-Triazole-4-carboxylic acid, 1-[(2-fluorophenyl)methyl]-

Description:

1H-1,2,3-Triazole-4-carboxylic acid, 1-[(2-fluorophenyl)methyl]- is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential for forming hydrogen bonds. The presence of the 2-fluorophenylmethyl substituent introduces aromatic characteristics and influences the compound's reactivity and solubility. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and drug development. The triazole moiety is often associated with antifungal and antimicrobial properties, while the fluorinated aromatic group can enhance lipophilicity and metabolic stability. Additionally, the compound's structural features may allow for various synthetic modifications, making it a versatile building block in organic synthesis. Overall, this compound exemplifies the intersection of heterocyclic chemistry and functional group reactivity, with potential applications in pharmaceuticals and agrochemicals.

Formula: C₁₀H₈FN₃O₂

InChI: InChI=1S/C10H8FN3O2/c11-8-4-2-1-3-7(8)5-14-6-9(10(15)16)12-13-14/h1-4,6H,5H2,(H,15,16)

InChI key: InChIKey=QOQJFBGZXPUNOZ-UHFFFAOYSA-N

SMILES: C(N1C=C(C(O)=O)N=N1)C2=C(F)C=CC=C2

Synonyms:

• 1H-1,2,3-Triazole-4-carboxylic acid, 1-[(2-fluorophenyl)methyl]-
• 1-[(2-Fluorophenyl)methyl]-1H-1,2,3-triazole-4-carboxylic acid

1-[(2-fluorophenyl)methyl]-1H-1,2,3-triazole-4-carboxylic acid

CAS: 106308-42-3

Formula: C₁₀H₈FN₃O₂

Purity: >95%

Molecular weight: 221.191

Ref: 10-F550503