CAS 106308-57-0
:1H-1,2,3-Triazole-4-carboxylic acid, 1-[(2-chloro-6-fluorophenyl)methyl]-
Description:
1H-1,2,3-Triazole-4-carboxylic acid, 1-[(2-chloro-6-fluorophenyl)methyl]- is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of the 2-chloro-6-fluorophenyl group indicates that it has halogen substituents, which can influence its biological activity and solubility. The compound is likely to exhibit properties typical of triazoles, such as potential antimicrobial or antifungal activity, making it of interest in pharmaceutical research. Additionally, the specific arrangement of substituents can affect its interaction with biological targets, enhancing its utility in medicinal chemistry. Overall, this compound represents a class of triazole derivatives that may have significant applications in drug development and other chemical applications.
Formula:C10H7ClFN3O2
InChI:InChI=1S/C10H7ClFN3O2/c11-7-2-1-3-8(12)6(7)4-15-5-9(10(16)17)13-14-15/h1-3,5H,4H2,(H,16,17)
InChI key:VYWRVJMXJSWKDJ-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1)Cl)CN2C=C(N=N2)C(=O)O)F
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery