CAS 106308-60-5
:2-(Azidomethyl)-1,3-difluorobenzene
Description:
2-(Azidomethyl)-1,3-difluorobenzene is an organic compound characterized by the presence of both azide and difluorobenzene functional groups. Its molecular structure features a benzene ring substituted with two fluorine atoms at the 1 and 3 positions and an azidomethyl group at the 2 position. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its reactivity due to the azide group, which can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The difluorobenzene moiety contributes to its unique electronic properties, influencing its reactivity and stability. Additionally, the presence of fluorine atoms can enhance lipophilicity and alter the compound's solubility in organic solvents. Safety precautions are necessary when handling this compound, as azides can be potentially explosive under certain conditions. Overall, 2-(Azidomethyl)-1,3-difluorobenzene serves as a valuable intermediate in organic synthesis and materials science.
Formula:C7H5F2N3
InChI:InChI=1S/C7H5F2N3/c8-6-2-1-3-7(9)5(6)4-11-12-10/h1-3H,4H2
InChI key:InChIKey=JSZUBPHMRHROHZ-UHFFFAOYSA-N
SMILES:C(N=[N+]=[N-])C1=C(F)C=CC=C1F
Synonyms:- 2-(Azidomethyl)-1,3-difluorobenzene
- Benzene, 2-(Azidomethyl)-1,3-Difluoro-
- 2,6-Difluorobenzyl azide
- 2,6-Difluorobenzyl azide
- Rufinamide Impurity 13
- RufimideImpurity14
- Rufinamide Impurity
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2,6-Difluorobenzyl Azide
CAS:Controlled ProductApplications 2-(azidomethyl)-1,3-difluorobenzene (cas# 106308-60-5) is a useful research chemical.
Formula:C7H5F2N3Color and Shape:NeatMolecular weight:169.13


