
CAS 106331-73-1
:Methyl 2-methoxy-4-thiazolecarboxylate
Description:
Methyl 2-methoxy-4-thiazolecarboxylate is an organic compound characterized by its thiazole ring, which contributes to its unique chemical properties. This compound features a methoxy group and a carboxylate ester functional group, making it a versatile intermediate in organic synthesis. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the thiazole moiety imparts biological activity, often making such compounds of interest in medicinal chemistry and agrochemical applications. Methyl 2-methoxy-4-thiazolecarboxylate is soluble in organic solvents, which facilitates its use in various chemical reactions. Its reactivity is influenced by the electron-withdrawing nature of the thiazole ring, allowing for nucleophilic substitutions and other transformations. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during its use in laboratory or industrial settings.
Formula:C6H7NO3S
InChI:InChI=1S/C6H7NO3S/c1-9-5(8)4-3-11-6(7-4)10-2/h3H,1-2H3
InChI key:InChIKey=VJYGMCVDXIWGKO-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N=C(OC)SC1
Synonyms:- 4-Thiazolecarboxylic acid, 2-methoxy-, methyl ester
- Methyl 2-methoxy-4-thiazolecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.