CAS 106331-74-2

2-Methoxy-4-thiazolemethanol

Description:

2-Methoxy-4-thiazolemethanol is an organic compound characterized by the presence of a thiazole ring, a methoxy group, and a hydroxymethyl group. Its molecular structure features a five-membered thiazole ring, which contributes to its heterocyclic nature, and the methoxy group enhances its solubility in organic solvents. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits moderate polarity due to the presence of both the methoxy and hydroxymethyl groups, which can participate in hydrogen bonding. 2-Methoxy-4-thiazolemethanol may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, owing to its unique functional groups that can undergo various chemical reactions. Additionally, the thiazole moiety is often associated with biological activity, making this compound of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₅H₇NO₂S

InChI: InChI=1S/C5H7NO2S/c1-8-5-6-4(2-7)3-9-5/h3,7H,2H2,1H3

InChI key: InChIKey=NZEKOXCXGXCSQP-UHFFFAOYSA-N

SMILES: C(O)C=1N=C(OC)SC1

Synonyms:

• 4-Thiazolemethanol, 2-methoxy-
• (2-Methoxy-1,3-thiazol-4-yl)methanol
• 2-Methoxy-4-thiazolemethanol