CAS 106372-59-2
:ETHYL FLUORO(PHENYLTHIO)ACETATE
Description:
Ethyl fluoro(phenylthio)acetate is an organic compound characterized by the presence of an ethyl ester functional group, a fluorine atom, and a phenylthio group. Its molecular structure features a central acetate moiety, where the ethyl group is attached to the carbonyl carbon, and a phenylthio substituent linked to the alpha carbon. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its reactivity due to the presence of the fluorine atom, which can influence its chemical behavior, making it useful in various synthetic applications, particularly in the field of medicinal chemistry and agrochemicals. Ethyl fluoro(phenylthio)acetate may exhibit moderate to low solubility in water but is generally soluble in organic solvents. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and eyes, and potential toxicity if ingested or inhaled. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety.
Formula:C10H11FO2S
InChI:InChI=1/C10H11FO2S/c1-2-13-10(12)9(11)14-8-6-4-3-5-7-8/h3-7,9H,2H2,1H3
SMILES:CCOC(=O)C(F)Sc1ccccc1
Synonyms:- Fluoro(Phenylthio)Acetic Acid Ethyl Ester
- Ethyl 2-Fluoro-2-Phenylsulfanyl-Acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.