CAS 106401-68-7: (8S,10S)-10-[(3-Amino-2,3,6-trideoxy-α-<span class="text-smallcaps">L</span>-lyxo-hexopyranosyl)oxy]-8-(2-bromo-1,1-dimethoxyethyl)-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-5,12-naphthacenedione
Description:The chemical substance with the name "(8S,10S)-10-[(3-Amino-2,3,6-trideoxy-α-L-lyxo-hexopyranosyl)oxy]-8-(2-bromo-1,1-dimethoxyethyl)-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-5,12-naphthacenedione" and CAS number "106401-68-7" is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as hydroxyl (-OH), methoxy (-OCH3), and amino (-NH2) groups. This compound features a naphthacenedione core, which contributes to its potential biological activity. The presence of a sugar moiety, specifically a trideoxy-hexopyranosyl unit, suggests that it may exhibit glycosidic properties, potentially influencing its solubility and interaction with biological systems. The brominated and methoxy-substituted ethyl group adds to its structural diversity, which may affect its reactivity and pharmacological profile. Overall, this compound's unique combination of features positions it as a candidate for further investigation in medicinal chemistry and related fields, particularly in the context of its potential therapeutic applications.
Formula:C29H34BrNO11
InChI:InChI=1S/C29H34BrNO11/c1-12-23(32)15(31)8-18(41-12)42-17-10-28(37,29(11-30,39-3)40-4)9-14-20(17)27(36)22-21(25(14)34)24(33)13-6-5-7-16(38-2)19(13)26(22)35/h5-7,12,15,17-18,23,32,34,36-37H,8-11,31H2,1-4H3/t12-,15-,17-,18-,23+,28-/m0/s1
InChI key:InChIKey=JIMPRCTWUQVCIT-BJRCHLRVSA-N
SMILES:O=C1C=2C=CC=C(OC)C2C(=O)C=3C(O)=C4C(=C(O)C13)CC(O)(CC4OC5OC(C)C(O)C(N)C5)C(OC)(OC)CBr
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Doxorubicin Impurity B
Ref: 3D-AD64741
5mg | 439.00 € | ||
10mg | 488.00 € | ||
25mg | 732.00 € | ||
50mg | 1,024.00 € | ||
100mg | 1,575.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
(8S,10S)-10-[(3-Amino-2,3,6-trideoxy-α-L-lyxo-hexopyranosyl)oxy]-8-(2-bromo-1,1-dimethoxyethyl)-7,8,9,10-tetrahydro-6,8,11-trihydroxy-1-methoxy-5,12-naphthacenedione-d6(Doxorubicin Impurity)
Controlled ProductRef: TR-A630407
5mg | 1,136.00 € |