
CAS 106420-93-3
:2-Hydroxy-4-(hydroxymethyl)benzoic acid
Description:
2-Hydroxy-4-(hydroxymethyl)benzoic acid, also known as salicylic acid derivative, is an organic compound characterized by its aromatic structure featuring a hydroxyl group and a carboxylic acid functional group. This compound is typically a white to off-white crystalline solid, soluble in water and organic solvents, which enhances its utility in various applications. It exhibits both acidic and phenolic properties, making it useful in biochemical and pharmaceutical contexts. The presence of hydroxymethyl groups contributes to its reactivity and potential as a building block in organic synthesis. Additionally, it may possess biological activity, including anti-inflammatory and antimicrobial properties, which can be beneficial in medicinal chemistry. Its CAS number, 106420-93-3, allows for precise identification in chemical databases and regulatory contexts. Overall, 2-Hydroxy-4-(hydroxymethyl)benzoic acid is a versatile compound with significant relevance in both industrial and research applications.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c9-4-5-1-2-6(8(11)12)7(10)3-5/h1-3,9-10H,4H2,(H,11,12)
InChI key:InChIKey=DSQWHAJLUOQMFI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(O)C=C(CO)C=C1
Synonyms:- 2-Hydroxy-4-(hydroxymethyl)benzoic acid
- 2,4-Cresotic acid, α-hydroxy-
- Benzoic acid, 2-hydroxy-4-(hydroxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.