CAS 106428-05-1
:3-Fluoro-2-methoxybenzoic acid
Description:
3-Fluoro-2-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a methoxy group on a benzene ring. The fluorine substituent is located at the meta position relative to the carboxylic acid group, while the methoxy group is positioned ortho to the carboxylic acid. This compound typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The methoxy group contributes to the compound's overall electron-donating properties, influencing its reactivity and interaction with other chemical species. Additionally, the presence of the fluorine atom can enhance the acidity of the carboxylic acid compared to its non-fluorinated counterparts, as fluorine is highly electronegative. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and utility in synthetic chemistry. As with many organic compounds, proper handling and safety precautions are essential when working with 3-fluoro-2-methoxybenzoic acid.
Formula:C8H7FO3
InChI:InChI=1S/C8H7FO3/c1-12-7-5(8(10)11)3-2-4-6(7)9/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=MEOOXZGGYVXUSG-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(O)=O)C=CC=C1F
Synonyms:- 3-Fluoro-2-methoxybenzoic acid
- Benzoic acid, 3-fluoro-2-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Fluoro-2-methoxybenzoic acid
CAS:Formula:C8H7FO3Purity:98%Color and Shape:SolidMolecular weight:170.13783-Fluoro-2-methoxybenzoic acid
CAS:3-Fluoro-2-methoxybenzoic acid
Formula:C8H7FO3Purity:≥95%Color and Shape:White To Off White PowderMolecular weight:170.14g/mol3-Fluoro-2-methoxybenzoic acid
CAS:3-Fluoro-2-methoxybenzoic acid is a chemical compound that is used as a reaction component, reagent, and building block for fine chemicals. It is a versatile intermediate that is useful in the preparation of complex compounds. 3-Fluoro-2-methoxybenzoic acid has been used to synthesize pharmaceuticals, including antipsychotics and anticonvulsants, as well as dyes and pesticides. 3-Fluoro-2-methoxybenzoic acid belongs to the speciality chemical category and can be used in research labs or other specialized settings.
3-Fluoro-2-methoxybenzoic acid has CAS No. 106428-05-1.Formula:C8H7FO3Purity:Min. 95%Color and Shape:PowderMolecular weight:170.14 g/mol3-Fluoro-2-methoxybenzoic acid
CAS:Formula:C8H7FO3Purity:98%Color and Shape:SolidMolecular weight:170.139



