
CAS 106429-58-7
:1,3-Dihydro-5-(hydroxymethyl)-2H-benzimidazol-2-one
Description:
1,3-Dihydro-5-(hydroxymethyl)-2H-benzimidazol-2-one, with the CAS number 106429-58-7, is a chemical compound that belongs to the class of benzimidazoles, which are known for their diverse biological activities. This compound features a bicyclic structure that includes a benzimidazole moiety, characterized by a fused benzene and imidazole ring. The presence of a hydroxymethyl group enhances its solubility and potential reactivity, making it a candidate for various chemical reactions and applications. It is typically a white to off-white solid and may exhibit moderate stability under standard conditions. The compound's unique structure allows it to interact with biological systems, which has led to research into its pharmacological properties, including potential antimicrobial and anticancer activities. As with many organic compounds, its behavior in biological systems can be influenced by factors such as pH, solvent, and temperature. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H8N2O2
InChI:InChI=1S/C8H8N2O2/c11-4-5-1-2-6-7(3-5)10-8(12)9-6/h1-3,11H,4H2,(H2,9,10,12)
InChI key:InChIKey=UBXKTZMRHQPCFZ-UHFFFAOYSA-N
SMILES:O=C1NC=2C(=CC(CO)=CC2)N1
Synonyms:- 1,3-Dihydro-5-(hydroxymethyl)-2H-benzimidazol-2-one
- 2H-Benzimidazol-2-one, 1,3-dihydro-5-(hydroxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.