CAS 106429-67-8

(1H-BENZO[D][1,2,3]TRIAZOL-5-YL)METHANOL

Description:

(1H-Benzo[d][1,2,3]triazol-5-yl)methanol is a chemical compound characterized by its unique triazole ring structure fused to a benzene ring, which contributes to its aromatic properties. This compound features a hydroxymethyl group (-CH2OH) attached to the triazole moiety, enhancing its potential for hydrogen bonding and reactivity. It is typically a solid at room temperature and exhibits moderate solubility in polar solvents due to the presence of the hydroxymethyl group. The compound may display interesting biological activities, making it a subject of interest in medicinal chemistry and pharmacology. Its structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the presence of the triazole ring may impart stability and influence the compound's electronic properties, making it suitable for various chemical reactions. Safety data and handling precautions should be observed, as with any chemical substance, to ensure safe laboratory practices.

Formula: C₇H₇N₃O

InChI: InChI=1/C7H7N3O/c11-4-5-1-2-6-7(3-5)9-10-8-6/h1-3,11H,4H2,(H,8,9,10)

SMILES: c1cc2c(cc1CO)[nH]nn2

Synonyms:

• 1H-1,2,3-benzotriazole-5-methanol
• 1H-Benzotriazol-5-ylmethanol
• 2H-benzotriazol-5-ylmethanol

(1H-Benzo[d][1,2,3]triazol-5-yl)methanol

CAS: 106429-67-8

(1H-Benzo[d][1,2,3]triazol-5-yl)methanol

Purity: 95%

Molecular weight: 149.15g/mol

Ref: 54-OR1044794

1H-1,2,3-Benzotriazol-5-ylmethanol

CAS: 106429-67-8

Versatile small molecule scaffold

Formula: C₇H₇N₃O

Purity: Min. 95%

Molecular weight: 149.15 g/mol

Ref: 3D-GEA42967