CAS 106445-35-6: Nonanoic acid, 9-[[O-2-(acetylamino)-2-deoxy-β-D-glucopyranosyl-(1→4)-O-[6-deoxy-α-L-galactopyranosyl-(1→6)]-2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]oxy]-, methyl ester
Description:Nonanoic acid, also known as pelargonic acid, is a nine-carbon saturated fatty acid characterized by its straight-chain structure and a carboxylic acid functional group. The compound you referenced is a complex derivative that includes a methyl ester of nonanoic acid linked to a glycosylated structure, which suggests it has both hydrophobic and hydrophilic properties. This amphiphilic nature can influence its solubility in various solvents, making it potentially useful in biochemical applications. The presence of acetylamino groups indicates that it may participate in biological interactions, possibly enhancing its reactivity or bioavailability. The glycosylation aspect implies that it could be involved in cellular recognition processes or serve as a substrate for enzymatic reactions. Overall, this compound's unique structure may confer specific functionalities in pharmaceutical or biochemical contexts, although detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C32H56N2O17
InChI:InChI=1S/C32H56N2O17/c1-15-23(39)27(43)28(44)32(48-15)47-14-19-29(51-31-21(33-16(2)36)25(41)24(40)18(13-35)49-31)26(42)22(34-17(3)37)30(50-19)46-12-10-8-6-5-7-9-11-20(38)45-4/h15,18-19,21-32,35,39-44H,5-14H2,1-4H3,(H,33,36)(H,34,37)
InChI key:InChIKey=XCELICOVZHQPEF-UHFFFAOYSA-N
SMILES:O=C(OC)CCCCCCCCOC1OC(COC2OC(C)C(O)C(O)C2O)C(OC3OC(CO)C(O)C(O)C3NC(=O)C)C(O)C1NC(=O)C
- Synonyms:
- Nonanoic acid, 9-[[O-2-(acetylamino)-2-deoxy-β-D-glucopyranosyl-(1→4)-O-[6-deoxy-α-L-galactopyranosyl-(1→6)]-2-(acetylamino)-2-deoxy-β-D-glucopyranosyl]oxy]-, methyl ester

8-Methoxycarbonyloctyl 2-acetamido-4-O-(2-acetamido-2-deoxy-b-D-glucopyranosyl)-2-deoxy-6-O-(a-L-fucopyranosyl)-b-D-glucopyranoside
Ref: 7W-GC4546
Undefined size | To inquire |

8-Methoxycarbonyloctyl-6-O-(a-L-fucopyranosyl)-N,N'-diacetyl-chitobioside
Ref: 3D-OM06664
1mg | 362.00 € | ||
2mg | 564.00 € | ||
5mg | 1,011.00 € |