CymitQuimica logo

CAS 106447-41-0

:

7-Amino-8-oxo-3-(cis-prop-1-enyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid diphenylmethyl ester hydrochloride

Description:
7-Amino-8-oxo-3-(cis-prop-1-enyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid diphenylmethyl ester hydrochloride, with CAS number 106447-41-0, is a synthetic compound that belongs to a class of bicyclic compounds featuring a thiazole ring. This substance is characterized by its unique bicyclic structure, which includes an amino group and a keto group, contributing to its potential biological activity. The presence of the diphenylmethyl ester moiety enhances its lipophilicity, potentially influencing its pharmacokinetic properties. As a hydrochloride salt, it is likely to exhibit improved solubility in aqueous environments, which is advantageous for pharmaceutical applications. The compound may possess antimicrobial or antiviral properties, as suggested by its structural similarities to other bioactive molecules. However, specific biological activities, toxicity, and therapeutic uses would require further investigation through experimental studies. Overall, this compound represents a complex structure with potential implications in medicinal chemistry and drug development.
Formula:C23H23ClN2O3S
InChI:InChI=1/C23H22N2O3S.ClH/c1-2-9-17-14-29-22-18(24)21(26)25(22)19(17)23(27)28-20(15-10-5-3-6-11-15)16-12-7-4-8-13-16;/h2-13,18,20,22H,14,24H2,1H3;1H
SMILES:CC=CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(C2SC1)N.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.