CAS 106447-61-4

3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methyl-4,5-dihydro-6H-imidazo[1,5-a][1,4]benzodiazepin-6-one

Description:

The chemical substance known as 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-5-methyl-4,5-dihydro-6H-imidazo[1,5-a][1,4]benzodiazepin-6-one, with the CAS number 106447-61-4, is a complex organic compound characterized by its unique bicyclic structure that incorporates both imidazo and benzodiazepine moieties. This compound features a cyclopropyl group and an oxadiazole ring, contributing to its potential biological activity. The presence of multiple heteroatoms, including nitrogen and oxygen, suggests that it may exhibit interesting pharmacological properties, possibly influencing its interaction with biological targets. Its structural complexity may also imply specific solubility and stability characteristics, which are crucial for its application in medicinal chemistry. The compound's synthesis and characterization would typically involve advanced organic synthesis techniques, and its potential uses could range from pharmaceuticals to agrochemicals, depending on its biological activity and efficacy. Further studies would be necessary to elucidate its mechanism of action and therapeutic potential.

Formula: C₁₇H₁₅N₅O₂

InChI: InChI=1/C17H15N5O2/c1-21-8-13-14(15-19-16(24-20-15)10-6-7-10)18-9-22(13)12-5-3-2-4-11(12)17(21)23/h2-5,9-10H,6-8H2,1H3

SMILES: CN1Cc2c(c3nc(C4CC4)on3)ncn2c2ccccc2C1=O

Synonyms:

• 6H-Imidazo(1,5-a)(1,4)benzodiazepin-6-one, 3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)-4,5-dihydro-5-methyl-

FG8119

CAS: 106447-61-4

FG8119

Purity: ≥98%

Molecular weight: 321.33g/mol

Ref: 54-BUP21637

FG8119

CAS: 106447-61-4

FG8119 is a peptide that can be used as a research tool to study the interactions between proteins and receptors. FG8119 is an activator of ion channels, which are protein pores that allow ions to pass through the cell membrane. FG8119 is also an inhibitor of protein interactions and has been shown to inhibit receptor-ligand binding in pharmacological studies.

Formula: C₁₇H₁₅N₅O₂

Purity: Min. 95%

Molecular weight: 321.33 g/mol

Ref: 3D-GEA44761

FG8119

CAS: 106447-61-4

FG8119 is a novel benzodiazepine agonist with potential anticonvulsant and antiepileptic activity for the study of neurological disorders.

Formula: C₁₇H₁₅N₅O₂

Purity: >99.99%

Color and Shape: Solid

Molecular weight: 321.33

Ref: TM-T11278