CAS 106447-97-6
:2-Amino-4-(trifluoromethyl)pyridine
Description:
2-Amino-4-(trifluoromethyl)pyridine is an organic compound characterized by the presence of an amino group and a trifluoromethyl group attached to a pyridine ring. Its molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The trifluoromethyl group significantly influences the compound's electronic properties, enhancing its lipophilicity and potentially affecting its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. It is often utilized in the synthesis of various pharmaceuticals and agrochemicals due to its unique functional groups, which can participate in nucleophilic substitution reactions and other chemical transformations. Additionally, the presence of fluorine atoms can impart desirable characteristics such as increased metabolic stability and altered pharmacokinetics in drug development. Safety data should be consulted for handling and storage, as compounds with trifluoromethyl groups can exhibit toxicity and environmental persistence.
Formula:C6H5F3N2
InChI:InChI=1/C6H5F3N2/c7-6(8,9)4-1-2-11-5(10)3-4/h1-3H,(H2,10,11)
SMILES:c1c[nH]c(=N)cc1C(F)(F)F
Synonyms:- 2-Amino-4-trifluoromethylpyridine
- 4-(Trifluoromethyl)Pyridin-2-Amine
- 4-Trifluoromethyl-2-pyridinamine
- 4-Trifluoromethyl-pyridin-2-ylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Amino-4-(trifluoromethyl)pyridine, 99%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H5F3N2Purity:99%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:162.122-Amino-4-(trifluoromethyl)pyridine
CAS:Formula:C6H5F3N2Purity:98%Color and Shape:SolidMolecular weight:162.11252-Amino-4-(trifluoromethyl)pyridine
CAS:2-Amino-4-(trifluoromethyl)pyridineFormula:C6H5F3N2Purity:≥95%Color and Shape: off-white crystalsMolecular weight:162.11g/mol2-Amino-4-(trifluoromethyl)pyridine
CAS:Formula:C6H5F3N2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:162.122-Amino-4-(trifluoromethyl)pyridine
CAS:Formula:C6H5F3N2Purity:98%Color and Shape:SolidMolecular weight:162.115





