CAS 106454-65-3
:(R)-cyano(3-phenoxyphenyl)methyl (1S,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarboxylate
Description:
(R)-cyano(3-phenoxyphenyl)methyl (1S,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarboxylate, with CAS number 106454-65-3, is a synthetic organic compound characterized by its complex molecular structure, which includes a cyano group, a phenoxyphenyl moiety, and a cyclopropanecarboxylate functional group. This compound is notable for its chirality, as indicated by the (R) and (S) designations, which suggest specific spatial arrangements of its atoms that can influence its reactivity and biological activity. The presence of the dibromoethenyl group introduces significant halogenation, which can enhance its reactivity and potential applications in various chemical reactions. Typically, compounds of this nature may exhibit properties such as insecticidal or herbicidal activity, making them of interest in agricultural chemistry. Additionally, the stability and solubility of this compound can be influenced by the presence of the bulky dimethyl groups and the phenoxy substituent, which may affect its interactions in biological systems or its behavior in environmental contexts.
Formula:C22H19Br2NO3
InChI:InChI=1/C22H19Br2NO3/c1-22(2)17(12-19(23)24)20(22)21(26)28-18(13-25)14-7-6-10-16(11-14)27-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/t17-,18-,20+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1S,3R,alphaR-Deltamethrin
CAS:Controlled ProductFormula:C22H19Br2NO3Color and Shape:NeatMolecular weight:505.199
