CAS 1064783-30-7

5-Chloro-3-fluoro-4-iodo-2-pyridinamine

Description:

5-Chloro-3-fluoro-4-iodo-2-pyridinamine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of halogen substituents—specifically chlorine, fluorine, and iodine—at the 5, 3, and 4 positions, respectively, contributes to its unique chemical properties and reactivity. This compound is likely to exhibit polar characteristics due to the electronegative halogens, which can influence its solubility in various solvents. The amino group at the 2-position enhances its potential for hydrogen bonding, making it a candidate for various biological activities. Additionally, the presence of multiple halogens may impart interesting pharmacological properties, making it relevant in medicinal chemistry. Its molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals, where such halogenated pyridine derivatives are often explored for their biological activity. As with many halogenated compounds, care must be taken regarding environmental and health impacts during handling and disposal.

Formula: C₅H₃ClFIN₂

InChI: InChI=1S/C5H3ClFIN2/c6-2-1-10-5(9)3(7)4(2)8/h1H,(H2,9,10)

InChI key: InChIKey=OTCFXYOWHRKWAX-UHFFFAOYSA-N

SMILES: FC=1C(I)=C(Cl)C=NC1N

Synonyms:

• 2-Pyridinamine, 5-chloro-3-fluoro-4-iodo-
• 5-Chloro-3-fluoro-4-iodopyridin-2-amine
• 5-Chloro-3-fluoro-4-iodo-2-pyridinamine

5-Chloro-3-fluoro-4-iodopyridin-2-amine

CAS: 1064783-30-7

Versatile small molecule scaffold

Formula: C₅H₃ClFIN₂

Purity: Min. 95%

Molecular weight: 272.45 g/mol

Ref: 3D-PSB78330