CAS 106492-70-0
:3-CHLORO-N-SULPHAMYLPROPIONAMIDINE
Description:
3-Chloro-N-sulphamylpropionamidine, with the CAS number 106492-70-0, is a chemical compound that belongs to the class of sulfonamides, which are characterized by the presence of a sulfonamide group (-SO2NH2) attached to an amine. This compound features a chloro substituent, which can influence its reactivity and biological activity. Typically, sulfonamides exhibit antibacterial properties, and their mechanism often involves inhibition of bacterial folic acid synthesis. The presence of the propionamidine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's solubility, stability, and reactivity can vary based on its molecular structure and the functional groups present. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as sulfonamides can have adverse effects in certain contexts. Overall, 3-chloro-N-sulphamylpropionamidine represents a compound of interest in both synthetic and medicinal chemistry.
Formula:C3H8ClN3O2S
InChI:InChI=1/C3H8ClN3O2S/c4-2-1-3(5)7-10(6,8)9/h1-2H2,(H2,5,7)(H2,6,8,9)
SMILES:C(CCl)C(=N)NS(=O)(=O)N
Synonyms:- N-Sulphamyl-3-Chloropropioamidine
- Propanimidamide, N-(Aminosulfonyl)-3-Chloro-
- Zerenex Zx006504
- N-Sulfamyl-3-Chloropropinamidefamotidine Hcl
- 3-chloro-N'-sulfamoylpropanimidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
