CymitQuimica logo

CAS 1065-49-2

:

tetrakis(pentafluorophenyl)stannane

Description:
Tetrakis(pentafluorophenyl)stannane, with the CAS number 1065-49-2, is an organotin compound characterized by the presence of a tin atom bonded to four pentafluorophenyl groups. This compound exhibits a high degree of fluorination, which imparts unique properties such as increased thermal stability and hydrophobicity. The pentafluorophenyl groups contribute to its electron-withdrawing characteristics, making the compound a potential candidate for applications in materials science and organometallic chemistry. Tetrakis(pentafluorophenyl)stannane is typically a solid at room temperature and may exhibit low solubility in common organic solvents due to its bulky and highly fluorinated structure. Its synthesis often involves the reaction of tin compounds with pentafluorophenyl halides. The compound's reactivity can be influenced by the presence of the fluorinated groups, which can affect its coordination chemistry and interactions with other molecules. Overall, tetrakis(pentafluorophenyl)stannane is of interest for its unique chemical properties and potential applications in various fields, including catalysis and materials development.
Formula:C24F20Sn
InChI:InChI=1/4C6F5.Sn/c4*7-2-1-3(8)5(10)6(11)4(2)9;/rC24F20Sn/c25-1-5(29)13(37)21(14(38)6(1)30)45(22-15(39)7(31)2(26)8(32)16(22)40,23-17(41)9(33)3(27)10(34)18(23)42)24-19(43)11(35)4(28)12(36)20(24)44
SMILES:c1(c(c(c(c(c1F)F)[Sn](c1c(c(c(c(c1F)F)F)F)F)(c1c(c(c(c(c1F)F)F)F)F)c1c(c(c(c(c1F)F)F)F)F)F)F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.