CAS 106500-25-8

Azadirachtin B

Description:

Azadirachtin B is a complex tetranortriterpenoid compound derived from the seeds of the neem tree (Azadirachta indica). It is primarily known for its insecticidal and anti-feedant properties, making it a valuable natural pesticide in agricultural practices. Azadirachtin B functions by disrupting the hormonal systems of insects, inhibiting their growth and reproduction. The compound is characterized by its relatively low toxicity to mammals and beneficial insects, which enhances its appeal as an environmentally friendly alternative to synthetic pesticides. It is typically found in a mixture with other azadirachtin compounds, with Azadirachtin A being the most prominent. The substance is soluble in organic solvents but has limited solubility in water, which influences its application methods. Additionally, Azadirachtin B exhibits a range of biological activities, including antifungal and antibacterial properties, contributing to its potential use in various fields beyond agriculture, such as medicine and veterinary science. Its stability and efficacy can be affected by environmental factors, necessitating careful formulation and application strategies.

Formula: C₃₃H₄₂O₁₄

InChI: InChI=1S/C33H42O14/c1-7-14(2)24(36)45-17-11-16(34)30-12-44-20(25(37)40-5)21(30)28(3,23(35)19-22(30)31(17,13-43-19)26(38)41-6)33-18-10-15(29(33,4)47-33)32(39)8-9-42-27(32)46-18/h7-9,15-23,27,34-35,39H,10-13H2,1-6H3/b14-7+/t15-,16+,17-,18+,19-,20+,21+,22-,23-,27+,28+,29+,30-,31+,32+,33+/m1/s1

InChI key: InChIKey=USRBWQQLHKQWAV-ZGKQVQOISA-N

SMILES: C[C@]1([C@@]23[C@@](C)(O2)[C@]4(C[C@@]3(O[C@]5([C@]4(O)C=CO5)[H])[H])[H])[C@]6([C@@]7([C@]8([C@]([C@H]1O)(OC[C@]8(C(OC)=O)[C@H](OC(/C(=C/C)/C)=O)C[C@@H]7O)[H])[H])CO[C@@H]6C(OC)=O)[H]

Synonyms:

• 2,7-Methanofuro[2,3-b]oxireno[e]oxepin, 1H,7H-naphtho[1,8-bc:4,4a-c′]difuran-5,10a(8H)-dicarboxylic acid deriv.
• 1H,7H-Naphtho[1,8-bc:4,4a-c′]difuran-5,10a(8H)-dicarboxylic acid, octahydro-3,8-dihydroxy-4-methyl-10-[[(2E)-2-methyl-1-oxo-2-butenyl]oxy]-4-[(1aR,2S,3aS,6aS,7S,7aS)-3a,6a,7,7a-tetrahydro-6a-hydroxy-7a-methyl-2,7-methanofuro[2,3-b]oxireno[e]oxepin-1a(2H)-yl]-, dimethyl ester, (2aR,3S,4S,4aR,5S,7aS,8S,10R,10aS,10bR)-
• 1H,7H-Naphtho[1,8-bc:4,4a-c′]difuran-5,10a(8H)-dicarboxylic acid, octahydro-3,8-dihydroxy-4-methyl-10-[(2-methyl-1-oxo-2-butenyl)oxy]-4-(3a,6a,7,7a-tetrahydro-6a-hydroxy-7a-methyl-2,7-methanofuro[2,3-b]oxireno[e]oxepin-1a(2H)-yl)-, dimethyl ester, [2aR-[2aα,3β,4β(1aR*,2S*,3aS*,6aS*,7S*,7aS*),4aβ,5β,7aS*,8β,10β(E),10aα,10bβ]]-
• 3-Tigloylazadirachtol
• 7H,8H-Furo[3′,4′:4,4a]naphtho[1,8-bc]furan-5,10a(1H)-dicarboxylic acid, octahydro-3,8-dihydroxy-4-methyl-10-[[(2E)-2-methyl-1-oxo-2-buten-1-yl]oxy]-4-[(1aR,2S,3aS,6aS,7S,7aS)-3a,6a,7,7a-tetrahydro-6a-hydroxy-7a-methyl-2,7-methanofuro[2,3-b]oxireno[e]oxepin-1a(2H)-yl]-, 5,10a-dimethyl ester, (2aR,3S,4S,4aR,5S,7aS,8S,10R,10aS,10bR)-

Azadirachtin B

CAS: 106500-25-8

Formula: C₃₃H₄₂O₁₄

Purity: 95%~99%

Molecular weight: 662.685

Ref: BP-BP5407

Azadirachtin B

CAS: 106500-25-8

Azadirachtin B (Deacetylazadirachtinol) is a terpene compound isolated from Azadirachta seeds, known for its insecticidal, anti-tumor, and anti-viral activities

Formula: C₃₃H₄₂O₁₄

Purity: 99.12%

Color and Shape: Solid

Molecular weight: 662.68

Ref: TM-T14368

Azadirachtin B

CAS: 106500-25-8

Applications Azadirachtin B is a drug analog of azadirachtin which was investigated in agrochemical studies of bioregulators for the antifeedant mode of action of parent molecule against Lepidoptera and locusts.
References Mordue, A. Jennifer., Pesticide Science, 54, 277-284, (1998)

Formula: C₃₃H₄₂O₁₄

Color and Shape: White To Light Yellow

Molecular weight: 662.68

Ref: TR-A797325

Azadirachtin B

CAS: 106500-25-8

Azadirachtin B is a bio-derived insecticidal compound, which is sourced from the seeds of the neem tree, Azadirachta indica. It belongs to a group of limonoids, which are naturally occurring compounds with significant biological activities. Azadirachtin B functions primarily as an insect growth regulator by disrupting the normal hormonal balance and interfering with the processes of molting and reproduction in insects. This mode of action targets the various stages of insect development, thereby inhibiting their growth and population proliferation.

Formula: C₃₃H₄₂O₁₄

Purity: Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 662.7 g/mol

Ref: 3D-GEA50025

Azadirachtin B

CAS: 106500-25-8

Formula: C₃₃H₄₂O₁₄

Molecular weight: 662.69

Ref: ST-EA-CP-A229005

Azadirachtin B

CAS: 106500-25-8

Formula: C₃₃H₄₂O₁₄

Molecular weight: 662.69

Ref: 4Z-A-274002