CymitQuimica logo

CAS 106507-42-0

:

5-methoxyninhydrin monohydrate

Description:
5-Methoxyninhydrin monohydrate is a chemical compound characterized by its unique structure and properties. It is a derivative of ninhydrin, which is widely used in analytical chemistry, particularly for detecting amino acids and proteins. The presence of the methoxy group enhances its reactivity and solubility in organic solvents. As a monohydrate, it contains one molecule of water, which can influence its stability and solubility in various conditions. This compound typically appears as a crystalline solid and may exhibit specific colorimetric properties when reacting with amino acids, leading to the formation of colored complexes. Its applications extend beyond analytical chemistry to include potential uses in organic synthesis and as a reagent in various chemical reactions. Safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled. Overall, 5-methoxyninhydrin monohydrate is a valuable compound in both research and industrial applications due to its reactivity and analytical capabilities.
Formula:C10H8O5
InChI:InChI=1/C10H8O5/c1-15-5-2-3-6-7(4-5)9(12)10(13,14)8(6)11/h2-4,13-14H,1H3
SMILES:COc1ccc2c(c1)C(=O)C(C2=O)(O)O
Synonyms:
  • 2,2-dihydroxy-5-methoxy-1H-indene-1,3(2H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.