CAS 1065073-98-4

Benzamide, 3-bromo-N-ethyl-4-fluoro-

Description:

Benzamide, 3-bromo-N-ethyl-4-fluoro- is an organic compound characterized by its benzamide structure, which consists of a benzene ring attached to a carbonyl group (C=O) and an amine (NH2) group. The specific substituents in this compound include a bromine atom at the 3-position and a fluorine atom at the 4-position of the benzene ring, along with an ethyl group attached to the nitrogen atom of the amide. This compound is likely to exhibit properties typical of halogenated amides, such as moderate solubility in organic solvents and potential reactivity due to the presence of the halogen substituents. The presence of the bromine and fluorine atoms can influence the compound's electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. Additionally, the ethyl group may affect the steric hindrance and overall stability of the molecule. As with many benzamide derivatives, it may have applications in pharmaceuticals or as an intermediate in organic synthesis.

Formula: C₉H₉BrFNO

InChI: InChI=1S/C9H9BrFNO/c1-2-12-9(13)6-3-4-8(11)7(10)5-6/h3-5H,2H2,1H3,(H,12,13)

InChI key: InChIKey=CDEMMEBEXFRGFM-UHFFFAOYSA-N

SMILES: C(NCC)(=O)C1=CC(Br)=C(F)C=C1

Synonyms:

• 3-Bromo-N-ethyl-4-fluorobenzamide
• Benzamide, 3-bromo-N-ethyl-4-fluoro-

N-Ethyl 3-bromo-4-fluorobenzamide

CAS: 1065073-98-4

Formula: C₉H₉BrFNO

Molecular weight: 246.0763

Ref: IN-DA003SZ7