CAS 1065074-04-5
:3-Bromo-4-fluoro-N-propylbenzamide
Description:
3-Bromo-4-fluoro-N-propylbenzamide is an organic compound characterized by the presence of a benzamide functional group, which consists of a benzene ring attached to a carbonyl group (C=O) and an amine (NH2) derivative. The specific structure includes a bromine atom at the 3-position and a fluorine atom at the 4-position of the benzene ring, along with a propyl group attached to the nitrogen of the amide. This compound is likely to exhibit moderate polarity due to the presence of the amide functional group, which can engage in hydrogen bonding. The halogen substituents (bromine and fluorine) can influence the compound's reactivity, stability, and lipophilicity, potentially affecting its biological activity and solubility in various solvents. Additionally, the presence of these halogens may impart unique electronic properties, making it of interest in medicinal chemistry and material science. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H11BrFNO
InChI:InChI=1S/C10H11BrFNO/c1-2-5-13-10(14)7-3-4-9(12)8(11)6-7/h3-4,6H,2,5H2,1H3,(H,13,14)
InChI key:InChIKey=BCVBKPOAPDTVGW-UHFFFAOYSA-N
SMILES:C(NCCC)(=O)C1=CC(Br)=C(F)C=C1
Synonyms:- Benzamide, 3-bromo-4-fluoro-N-propyl-
- 3-Bromo-4-fluoro-N-propylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
