CymitQuimica logo

CAS 1065074-31-8

:

Ethyl 2-[4-[(1,1-dimethylethoxy)carbonyl]-1-piperazinyl]-1,6-dihydro-6-oxo-5-pyrimidinecarboxylate

Description:
Ethyl 2-[4-[(1,1-dimethylethoxy)carbonyl]-1-piperazinyl]-1,6-dihydro-6-oxo-5-pyrimidinecarboxylate is a synthetic organic compound characterized by its complex structure, which includes a pyrimidine ring, a piperazine moiety, and an ethyl ester functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many pyrimidine derivatives. Its molecular structure suggests potential biological activity, possibly as a pharmaceutical agent, due to the presence of the piperazine ring, which is often associated with various therapeutic effects. The compound may also display stability under standard laboratory conditions, although specific stability data would depend on environmental factors such as temperature and pH. Additionally, the presence of the dimethylethoxycarbonyl group may influence its reactivity and interactions with other chemical species. Overall, this compound represents a class of molecules that could be of interest in medicinal chemistry and drug development.
Formula:C16H24N4O5
InChI:InChI=1S/C16H24N4O5/c1-5-24-13(22)11-10-17-14(18-12(11)21)19-6-8-20(9-7-19)15(23)25-16(2,3)4/h10H,5-9H2,1-4H3,(H,17,18,21)
InChI key:InChIKey=QKKFACJXVJWDAL-UHFFFAOYSA-N
SMILES:O=C1NC(=NC=C1C(OCC)=O)N2CCN(C(OC(C)(C)C)=O)CC2
Synonyms:
  • 5-Pyrimidinecarboxylic acid, 2-[4-[(1,1-dimethylethoxy)carbonyl]-1-piperazinyl]-1,6-dihydro-6-oxo-, ethyl ester
  • Ethyl 2-[4-[(1,1-dimethylethoxy)carbonyl]-1-piperazinyl]-1,6-dihydro-6-oxo-5-pyrimidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.