CAS 1065074-34-1
:3-(2-Bromophenyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole
Description:
3-(2-Bromophenyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in its five-membered structure. This compound features two distinct aromatic substituents: a brominated phenyl group and a dichlorinated phenyl group, contributing to its potential biological activity and chemical reactivity. The presence of halogen atoms, such as bromine and chlorine, often enhances the lipophilicity and can influence the compound's interaction with biological targets. The oxadiazole moiety is known for its applications in pharmaceuticals and agrochemicals, often exhibiting antimicrobial, anti-inflammatory, or anticancer properties. Additionally, the compound's molecular structure suggests potential for various synthetic modifications, making it a subject of interest in medicinal chemistry and materials science. Its stability, solubility, and reactivity would depend on the specific conditions and solvents used in experiments or applications.
Formula:C14H7BrCl2N2O
InChI:InChI=1S/C14H7BrCl2N2O/c15-10-6-2-1-4-8(10)13-18-14(20-19-13)9-5-3-7-11(16)12(9)17/h1-7H
InChI key:InChIKey=BITKEMIHQZIOMI-UHFFFAOYSA-N
SMILES:ClC1=C(C2=NC(=NO2)C3=C(Br)C=CC=C3)C=CC=C1Cl
Synonyms:- 1,2,4-Oxadiazole, 3-(2-bromophenyl)-5-(2,3-dichlorophenyl)-
- 3-(2-Bromophenyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(2-Bromophenyl)-5-(2,3-dichlorophenyl)-1,2,4-oxadiazole
CAS:Formula:C14H7BrCl2N2OMolecular weight:370.0282
