CAS 1065074-43-2
:4-Bromo-2-phenoxythiazole
Description:
4-Bromo-2-phenoxythiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of a bromine atom at the 4-position and a phenoxy group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic phenoxy group. It is often used in medicinal chemistry and research due to its potential biological activities, including antimicrobial and antifungal properties. The thiazole moiety is known for its ability to participate in various chemical reactions, making this compound a valuable intermediate in the synthesis of more complex molecules. Additionally, the presence of the bromine atom can enhance reactivity and facilitate further functionalization. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, 4-Bromo-2-phenoxythiazole is a significant compound in the field of organic synthesis and pharmaceutical development.
Formula:C9H6BrNOS
InChI:InChI=1S/C9H6BrNOS/c10-8-6-13-9(11-8)12-7-4-2-1-3-5-7/h1-6H
InChI key:InChIKey=YJESUUGBCWVUTC-UHFFFAOYSA-N
SMILES:O(C=1SC=C(Br)N1)C2=CC=CC=C2
Synonyms:- Thiazole, 4-bromo-2-phenoxy-
- 4-Bromo-2-phenoxythiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
