CAS 1065074-55-6
:Methyl 6,8-dichloro-1,4-dihydro-4-oxo-2-quinolinecarboxylate
Description:
Methyl 6,8-dichloro-1,4-dihydro-4-oxo-2-quinolinecarboxylate is a synthetic organic compound characterized by its quinoline structure, which features a bicyclic aromatic system. This compound contains two chlorine substituents at the 6 and 8 positions, contributing to its unique reactivity and potential biological activity. The presence of a methyl ester group at the carboxylic acid position enhances its solubility in organic solvents and may influence its pharmacokinetic properties. The 1,4-dihydro-4-oxo moiety indicates that it exists in a reduced form, which can be significant for its chemical behavior and interactions. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as quinoline derivatives are known for various biological activities, including antimicrobial and antitumor effects. Its specific properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods and may vary based on purity and environmental conditions.
Formula:C11H7Cl2NO3
InChI:InChI=1S/C11H7Cl2NO3/c1-17-11(16)8-4-9(15)6-2-5(12)3-7(13)10(6)14-8/h2-4H,1H3,(H,14,15)
InChI key:InChIKey=GPHBMGYRXSTKML-UHFFFAOYSA-N
SMILES:ClC1=C2C(C(=O)C=C(C(OC)=O)N2)=CC(Cl)=C1
Synonyms:- 2-Quinolinecarboxylic acid, 6,8-dichloro-1,4-dihydro-4-oxo-, methyl ester
- Methyl 6,8-dichloro-1,4-dihydro-4-oxo-2-quinolinecarboxylate
- Methyl 6,8-dichloro-4-oxo-1,4-dihydroquinoline-2-carboxylate
- 6,8-Dichloro-1,4-dihydro-4-oxo-2-quinolinecarboxylic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 6,8-dichloro-4-oxo-1,4-dihydroquinoline-2-carboxylate
CAS:Formula:C11H7Cl2NO3Molecular weight:272.0842
