CAS 1065074-57-8: Methyl 8-chloro-4-hydroxy-2-quinolinecarboxylate
Description:Methyl 8-chloro-4-hydroxy-2-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro group at the 8-position and a hydroxy group at the 4-position of the quinoline ring, contributing to its potential biological activity. The presence of the methyl ester functional group at the carboxylate position enhances its solubility and reactivity, making it suitable for various chemical reactions. This compound may exhibit properties such as antimicrobial or anti-inflammatory activities, which are common in quinoline derivatives. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the quinoline ring, which may affect its pharmacokinetic and pharmacodynamic profiles. Overall, Methyl 8-chloro-4-hydroxy-2-quinolinecarboxylate represents a class of compounds with potential applications in drug development and therapeutic research.
Formula:C11H8ClNO3
InChI:InChI=1S/C11H8ClNO3/c1-16-11(15)8-5-9(14)6-3-2-4-7(12)10(6)13-8/h2-5H,1H3,(H,13,14)
InChI key:InChIKey=XFZKOZSDFPFCAF-UHFFFAOYSA-N
SMILES:O=C(OC)C=1N=C2C(Cl)=CC=CC2=C(O)C1
- Synonyms:
- Methyl 8-chloro-4-hydroxy-2-quinolinecarboxylate
- 2-Quinolinecarboxylic acid, 8-chloro-4-hydroxy-, methyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Methyl 8-chloro-4-hydroxyquinoline-2-carboxylate REF: IN-DA003RZ1CAS: 1065074-57-8 | - - - | To inquire | Wed 26 Mar 25 |
![]() | Methyl 8-chloro-4-hydroxyquinoline-2-carboxylate REF: 10-F216044CAS: 1065074-57-8 | 95.0% | - - - | Discontinued product |
![]() | Methyl 8-chloro-4-hydroxyquinoline-2-carboxylate REF: 3D-QSB07457CAS: 1065074-57-8 | Min. 95% | - - - | Discontinued product |

Methyl 8-chloro-4-hydroxyquinoline-2-carboxylate
Ref: IN-DA003RZ1
Undefined size | To inquire |

Methyl 8-chloro-4-hydroxyquinoline-2-carboxylate
Ref: 10-F216044
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |

Methyl 8-chloro-4-hydroxyquinoline-2-carboxylate
Ref: 3D-QSB07457
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
500mg | Discontinued | Request information |