CAS 1065074-65-8: Methyl 2-amino-4-(4-chlorophenyl)-5-thiazolecarboxylate
Description:Methyl 2-amino-4-(4-chlorophenyl)-5-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a methyl ester functional group, contributing to its solubility in organic solvents. The presence of the 4-chlorophenyl group indicates that it has a chlorine substituent on a phenyl ring, which can influence its biological activity and reactivity. The amino group attached to the thiazole ring suggests potential for hydrogen bonding and reactivity in various chemical reactions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, potentially leading to applications in drug development. As with many thiazole derivatives, it may also possess antimicrobial or anti-inflammatory properties, although specific biological activities would need to be confirmed through experimental studies. Overall, Methyl 2-amino-4-(4-chlorophenyl)-5-thiazolecarboxylate is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C11H9ClN2O2S
InChI:InChI=1S/C11H9ClN2O2S/c1-16-10(15)9-8(14-11(13)17-9)6-2-4-7(12)5-3-6/h2-5H,1H3,(H2,13,14)
InChI key:InChIKey=RXFHPRRHAKGZMI-UHFFFAOYSA-N
SMILES:O=C(OC)C=1SC(=NC1C2=CC=C(Cl)C=C2)N
- Synonyms:
- Methyl 2-amino-4-(4-chlorophenyl)-5-thiazolecarboxylate
- 5-Thiazolecarboxylic acid, 2-amino-4-(4-chlorophenyl)-, methyl ester
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Methyl 2-amino-4-(4-chlorophenyl)thiazole-5-carboxylate REF: IN-DA008SU2CAS: 1065074-65-8 | - - - | To inquire | Mon 03 Mar 25 |
 | Methyl 2-amino-4-(4-chlorophenyl)thiazole-5-carboxylate REF: 10-F212483CAS: 1065074-65-8 | 95.0% | - - - | Discontinued product |
 | Methyl 2-amino-4-(4-chlorophenyl)thiazole-5-carboxylate REF: 3D-QSB07465CAS: 1065074-65-8 | Min. 95% | - - - | Discontinued product |
Methyl 2-amino-4-(4-chlorophenyl)thiazole-5-carboxylate
Ref: IN-DA008SU2
| Undefined size | To inquire |
Methyl 2-amino-4-(4-chlorophenyl)thiazole-5-carboxylate
Ref: 10-F212483
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information |
Methyl 2-amino-4-(4-chlorophenyl)thiazole-5-carboxylate
Ref: 3D-QSB07465
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
